C24H46O2Si2 — CID 46238476
[(1S,3aR,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-7a-methyl-1,2,3,3a,6,7-hexahydroinden-5-yl]oxy-triethylsilane (PubChem CID 46238476) has the molecular formula C24H46O2Si2 and a molecular weight of 422.80 g/mol. Its IUPAC name is [(1S,3aR,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-7a-methyl-1,2,3,3a,6,7-hexahydroinden-5-yl]oxy-triethylsilane.
| Compound Name | [(1S,3aR,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-7a-methyl-1,2,3,3a,6,7-hexahydroinden-5-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 46238476 |
| Molecular Formula | C24H46O2Si2 |
| Molecular Weight | 422.80 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | [(1S,3aR,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-4-ethenyl-7a-methyl-1,2,3,3a,6,7-hexahydroinden-5-yl]oxy-triethylsilane |
| SMILES | C=CC1=C(O[Si](CC)(CC)CC)CC[C@]2(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C24H46O2Si2/c1-11-19-20-15-16-22(26-27(9,10)23(5,6)7)24(20,8)18-17-21(19)25-28(12-2,13-3)14-4/h11,20,22H,1,12-18H2,2-10H3/t20-,22-,24-/m0/s1 |
| InChIKey | FTPCOEGLKIJLJL-SSPYTLHUSA-N |
| XLogP | 8.05 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.80 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|