About 2-hydroxybutanedioic acid;3-(oxan-4-yloxy)-5-[(E)-2-[(3R)-pyrrolidin-3-yl]ethenyl]pyridine
2-hydroxybutanedioic acid;3-(oxan-4-yloxy)-5-[(E)-2-[(3R)-pyrrolidin-3-yl]ethenyl]pyridine (PubChem CID 46238621) has the molecular formula C20H28N2O7
and a molecular weight of 408.45 g/mol. Its IUPAC name is 2-hydroxybutanedioic acid;3-(oxan-4-yloxy)-5-[(E)-2-[(3R)-pyrrolidin-3-yl]ethenyl]pyridine.
Molecular Properties
| Compound Name | 2-hydroxybutanedioic acid;3-(oxan-4-yloxy)-5-[(E)-2-[(3R)-pyrrolidin-3-yl]ethenyl]pyridine |
| PubChem CID | 46238621 |
| Molecular Formula | C20H28N2O7 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 2-hydroxybutanedioic acid;3-(oxan-4-yloxy)-5-[(E)-2-[(3R)-pyrrolidin-3-yl]ethenyl]pyridine |
| SMILES | C(=C/[C@H]1CCNC1)\c1cncc(OC2CCOCC2)c1.O=C(O)CC(O)C(=O)O |
| InChI | InChI=1S/C16H22N2O2.C4H6O5/c1(13-3-6-17-10-13)2-14-9-16(12-18-11-14)20-15-4-7-19-8-5-15;5-2(4(8)9)1-3(6)7/h1-2,9,11-13,15,17H,3-8,10H2;2,5H,1H2,(H,6,7)(H,8,9)/b2-1+;/t13-;/m0./s1 |
| InChIKey | UBIIBKJPYSAHHF-RRVIAKDDSA-N |
| XLogP | 1.17 |
| TPSA | 138.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-hydroxybutanedioic acid;3-(oxan-4-yloxy)-5-[(E)-2-[(3R)-pyrrolidin-3-yl]ethenyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybutanedioic acid;3-(oxan-4-yloxy)-5-[(E)-2-[(3R)-pyrrolidin-3-yl]ethenyl]pyridine?
The IUPAC name of 2-hydroxybutanedioic acid;3-(oxan-4-yloxy)-5-[(E)-2-[(3R)-pyrrolidin-3-yl]ethenyl]pyridine (CID 46238621) is 2-hydroxybutanedioic acid;3-(oxan-4-yloxy)-5-[(E)-2-[(3R)-pyrrolidin-3-yl]ethenyl]pyridine.
What is the SMILES notation for 2-hydroxybutanedioic acid;3-(oxan-4-yloxy)-5-[(E)-2-[(3R)-pyrrolidin-3-yl]ethenyl]pyridine?
The canonical SMILES for 2-hydroxybutanedioic acid;3-(oxan-4-yloxy)-5-[(E)-2-[(3R)-pyrrolidin-3-yl]ethenyl]pyridine is C(=C/[C@H]1CCNC1)\c1cncc(OC2CCOCC2)c1.O=C(O)CC(O)C(=O)O.
What is the InChIKey of 2-hydroxybutanedioic acid;3-(oxan-4-yloxy)-5-[(E)-2-[(3R)-pyrrolidin-3-yl]ethenyl]pyridine?
The InChIKey is UBIIBKJPYSAHHF-RRVIAKDDSA-N. The full InChI is InChI=1S/C16H22N2O2.C4H6O5/c1(13-3-6-17-10-13)2-14-9-16(12-18-11-14)20-15-4-7-19-8-5-15;5-2(4(8)9)1-3(6)7/h1-2,9,11-13,15,17H,3-8,10H2;2,5H,1H2,(H,6,7)(H,8,9)/b2-1+;/t13-;/m0./s1.
What are the key properties of 2-hydroxybutanedioic acid;3-(oxan-4-yloxy)-5-[(E)-2-[(3R)-pyrrolidin-3-yl]ethenyl]pyridine?
2-hydroxybutanedioic acid;3-(oxan-4-yloxy)-5-[(E)-2-[(3R)-pyrrolidin-3-yl]ethenyl]pyridine has a molecular weight of 408.45 g/mol, XLogP of 1.17, 7 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybutanedioic acid;3-(oxan-4-yloxy)-5-[(E)-2-[(3R)-pyrrolidin-3-yl]ethenyl]pyridine is sourced from PubChem (CID 46238621), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).