About methyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-3-phenylmethoxy-1H-pyridine-2-carboxylate
methyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-3-phenylmethoxy-1H-pyridine-2-carboxylate (PubChem CID 46239163) has the molecular formula C22H18F2N2O5
and a molecular weight of 428.39 g/mol. Its IUPAC name is methyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-3-phenylmethoxy-1H-pyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-3-phenylmethoxy-1H-pyridine-2-carboxylate |
| PubChem CID | 46239163 |
| Molecular Formula | C22H18F2N2O5 |
| Molecular Weight | 428.39 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | methyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-3-phenylmethoxy-1H-pyridine-2-carboxylate |
| SMILES | COC(=O)c1[nH]cc(C(=O)NCc2ccc(F)cc2F)c(=O)c1OCc1ccccc1 |
| InChI | InChI=1S/C22H18F2N2O5/c1-30-22(29)18-20(31-12-13-5-3-2-4-6-13)19(27)16(11-25-18)21(28)26-10-14-7-8-15(23)9-17(14)24/h2-9,11H,10,12H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | FBHXVCQZVVZLCC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 97.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.39 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-3-phenylmethoxy-1H-pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-3-phenylmethoxy-1H-pyridine-2-carboxylate?
The IUPAC name of methyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-3-phenylmethoxy-1H-pyridine-2-carboxylate (CID 46239163) is methyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-3-phenylmethoxy-1H-pyridine-2-carboxylate.
What is the SMILES notation for methyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-3-phenylmethoxy-1H-pyridine-2-carboxylate?
The canonical SMILES for methyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-3-phenylmethoxy-1H-pyridine-2-carboxylate is COC(=O)c1[nH]cc(C(=O)NCc2ccc(F)cc2F)c(=O)c1OCc1ccccc1.
What is the InChIKey of methyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-3-phenylmethoxy-1H-pyridine-2-carboxylate?
The InChIKey is FBHXVCQZVVZLCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H18F2N2O5/c1-30-22(29)18-20(31-12-13-5-3-2-4-6-13)19(27)16(11-25-18)21(28)26-10-14-7-8-15(23)9-17(14)24/h2-9,11H,10,12H2,1H3,(H,25,27)(H,26,28).
What are the key properties of methyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-3-phenylmethoxy-1H-pyridine-2-carboxylate?
methyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-3-phenylmethoxy-1H-pyridine-2-carboxylate has a molecular weight of 428.39 g/mol, XLogP of 2.95, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[(2,4-difluorophenyl)methylcarbamoyl]-4-oxo-3-phenylmethoxy-1H-pyridine-2-carboxylate is sourced from PubChem (CID 46239163), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).