C10H10O4 — CID 46239261
(4S)-4,5,8-trihydroxy-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 46239261) has the molecular formula C10H10O4 and a molecular weight of 194.19 g/mol. Its IUPAC name is (4S)-4,5,8-trihydroxy-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | (4S)-4,5,8-trihydroxy-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 46239261 |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.06 |
| IUPAC Name | (4S)-4,5,8-trihydroxy-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | O=C1CC[C@H](O)c2c(O)ccc(O)c21 |
| InChI | InChI=1S/C10H10O4/c11-5-1-2-6(12)10-8(14)4-3-7(13)9(5)10/h1-2,7,11-13H,3-4H2/t7-/m0/s1 |
| InChIKey | VIORJHPCHINTKE-ZETCQYMHSA-N |
| XLogP | 1.11 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|