C22H27NO3S — CID 46239358
(3R,5R)-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepine-8-carbaldehyde (PubChem CID 46239358) has the molecular formula C22H27NO3S and a molecular weight of 385.53 g/mol. Its IUPAC name is (3R,5R)-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepine-8-carbaldehyde.
| Compound Name | (3R,5R)-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepine-8-carbaldehyde |
|---|---|
| PubChem CID | 46239358 |
| Molecular Formula | C22H27NO3S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | (3R,5R)-3-butyl-3-ethyl-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepine-8-carbaldehyde |
| SMILES | CCCC[C@]1(CC)CS(=O)(=O)c2cc(C=O)ccc2[C@@H](c2ccccc2)N1 |
| InChI | InChI=1S/C22H27NO3S/c1-3-5-13-22(4-2)16-27(25,26)20-14-17(15-24)11-12-19(20)21(23-22)18-9-7-6-8-10-18/h6-12,14-15,21,23H,3-5,13,16H2,1-2H3/t21-,22-/m1/s1 |
| InChIKey | CUIOGHLHEDMPGP-FGZHOGPDSA-N |
| XLogP | 4.30 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|