C19H17F2NO3 — CID 46239501
2,2-difluoro-N-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl)-1,3-benzodioxole-5-carboxamide (PubChem CID 46239501) has the molecular formula C19H17F2NO3 and a molecular weight of 345.35 g/mol. Its IUPAC name is 2,2-difluoro-N-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | 2,2-difluoro-N-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 46239501 |
| Molecular Formula | C19H17F2NO3 |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 2,2-difluoro-N-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-6-yl)-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NC1CCCc2ccccc2C1)c1ccc2c(c1)OC(F)(F)O2 |
| InChI | InChI=1S/C19H17F2NO3/c20-19(21)24-16-9-8-14(11-17(16)25-19)18(23)22-15-7-3-6-12-4-1-2-5-13(12)10-15/h1-2,4-5,8-9,11,15H,3,6-7,10H2,(H,22,23) |
| InChIKey | GGMWKYHGGGQILJ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |