C22H20N4O — CID 46239553
naphthalen-2-yl-(4-piperazin-1-yl-1H-benzimidazol-2-yl)methanone (PubChem CID 46239553) has the molecular formula C22H20N4O and a molecular weight of 356.43 g/mol. Its IUPAC name is naphthalen-2-yl-(4-piperazin-1-yl-1H-benzimidazol-2-yl)methanone.
| Compound Name | naphthalen-2-yl-(4-piperazin-1-yl-1H-benzimidazol-2-yl)methanone |
|---|---|
| PubChem CID | 46239553 |
| Molecular Formula | C22H20N4O |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | naphthalen-2-yl-(4-piperazin-1-yl-1H-benzimidazol-2-yl)methanone |
| SMILES | O=C(c1ccc2ccccc2c1)c1nc2c(N3CCNCC3)cccc2[nH]1 |
| InChI | InChI=1S/C22H20N4O/c27-21(17-9-8-15-4-1-2-5-16(15)14-17)22-24-18-6-3-7-19(20(18)25-22)26-12-10-23-11-13-26/h1-9,14,23H,10-13H2,(H,24,25) |
| InChIKey | XZTDWCYCOFZWON-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |