About 6-chloro-3,8-dimethyl-2H-pyrazolo[3,4-b]quinoline
6-chloro-3,8-dimethyl-2H-pyrazolo[3,4-b]quinoline (PubChem CID 46239636) has the molecular formula C12H10ClN3
and a molecular weight of 231.69 g/mol. Its IUPAC name is 6-chloro-3,8-dimethyl-2H-pyrazolo[3,4-b]quinoline.
Molecular Properties
| Compound Name | 6-chloro-3,8-dimethyl-2H-pyrazolo[3,4-b]quinoline |
| PubChem CID | 46239636 |
| Molecular Formula | C12H10ClN3 |
| Molecular Weight | 231.69 g/mol |
| Exact Mass | 231.06 |
| IUPAC Name | 6-chloro-3,8-dimethyl-2H-pyrazolo[3,4-b]quinoline |
| SMILES | Cc1[nH]nc2nc3c(C)cc(Cl)cc3cc12 |
| InChI | InChI=1S/C12H10ClN3/c1-6-3-9(13)4-8-5-10-7(2)15-16-12(10)14-11(6)8/h3-5H,1-2H3,(H,14,15,16) |
| InChIKey | JGKXXUXMHUKJGW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.69 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chloro-3,8-dimethyl-2H-pyrazolo[3,4-b]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-3,8-dimethyl-2H-pyrazolo[3,4-b]quinoline?
The IUPAC name of 6-chloro-3,8-dimethyl-2H-pyrazolo[3,4-b]quinoline (CID 46239636) is 6-chloro-3,8-dimethyl-2H-pyrazolo[3,4-b]quinoline.
What is the SMILES notation for 6-chloro-3,8-dimethyl-2H-pyrazolo[3,4-b]quinoline?
The canonical SMILES for 6-chloro-3,8-dimethyl-2H-pyrazolo[3,4-b]quinoline is Cc1[nH]nc2nc3c(C)cc(Cl)cc3cc12.
What is the InChIKey of 6-chloro-3,8-dimethyl-2H-pyrazolo[3,4-b]quinoline?
The InChIKey is JGKXXUXMHUKJGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClN3/c1-6-3-9(13)4-8-5-10-7(2)15-16-12(10)14-11(6)8/h3-5H,1-2H3,(H,14,15,16).
What are the key properties of 6-chloro-3,8-dimethyl-2H-pyrazolo[3,4-b]quinoline?
6-chloro-3,8-dimethyl-2H-pyrazolo[3,4-b]quinoline has a molecular weight of 231.69 g/mol, XLogP of 3.38, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-3,8-dimethyl-2H-pyrazolo[3,4-b]quinoline is sourced from PubChem (CID 46239636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).