About 6-methoxy-3,8-dimethyl-4-piperazin-1-yl-2H-pyrazolo[3,4-b]quinoline
6-methoxy-3,8-dimethyl-4-piperazin-1-yl-2H-pyrazolo[3,4-b]quinoline (PubChem CID 46239840) has the molecular formula C17H21N5O
and a molecular weight of 311.39 g/mol. Its IUPAC name is 6-methoxy-3,8-dimethyl-4-piperazin-1-yl-2H-pyrazolo[3,4-b]quinoline.
Molecular Properties
| Compound Name | 6-methoxy-3,8-dimethyl-4-piperazin-1-yl-2H-pyrazolo[3,4-b]quinoline |
| PubChem CID | 46239840 |
| Molecular Formula | C17H21N5O |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 6-methoxy-3,8-dimethyl-4-piperazin-1-yl-2H-pyrazolo[3,4-b]quinoline |
| SMILES | COc1cc(C)c2nc3n[nH]c(C)c3c(N3CCNCC3)c2c1 |
| InChI | InChI=1S/C17H21N5O/c1-10-8-12(23-3)9-13-15(10)19-17-14(11(2)20-21-17)16(13)22-6-4-18-5-7-22/h8-9,18H,4-7H2,1-3H3,(H,19,20,21) |
| InChIKey | LRBQTFPUUPFJQW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-methoxy-3,8-dimethyl-4-piperazin-1-yl-2H-pyrazolo[3,4-b]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-3,8-dimethyl-4-piperazin-1-yl-2H-pyrazolo[3,4-b]quinoline?
The IUPAC name of 6-methoxy-3,8-dimethyl-4-piperazin-1-yl-2H-pyrazolo[3,4-b]quinoline (CID 46239840) is 6-methoxy-3,8-dimethyl-4-piperazin-1-yl-2H-pyrazolo[3,4-b]quinoline.
What is the SMILES notation for 6-methoxy-3,8-dimethyl-4-piperazin-1-yl-2H-pyrazolo[3,4-b]quinoline?
The canonical SMILES for 6-methoxy-3,8-dimethyl-4-piperazin-1-yl-2H-pyrazolo[3,4-b]quinoline is COc1cc(C)c2nc3n[nH]c(C)c3c(N3CCNCC3)c2c1.
What is the InChIKey of 6-methoxy-3,8-dimethyl-4-piperazin-1-yl-2H-pyrazolo[3,4-b]quinoline?
The InChIKey is LRBQTFPUUPFJQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N5O/c1-10-8-12(23-3)9-13-15(10)19-17-14(11(2)20-21-17)16(13)22-6-4-18-5-7-22/h8-9,18H,4-7H2,1-3H3,(H,19,20,21).
What are the key properties of 6-methoxy-3,8-dimethyl-4-piperazin-1-yl-2H-pyrazolo[3,4-b]quinoline?
6-methoxy-3,8-dimethyl-4-piperazin-1-yl-2H-pyrazolo[3,4-b]quinoline has a molecular weight of 311.39 g/mol, XLogP of 2.15, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-3,8-dimethyl-4-piperazin-1-yl-2H-pyrazolo[3,4-b]quinoline is sourced from PubChem (CID 46239840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).