C24H24F3N7 — CID 46240090
(11R,15S)-8-methyl-N-phenyl-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-5-amine (PubChem CID 46240090) has the molecular formula C24H24F3N7 and a molecular weight of 467.50 g/mol. Its IUPAC name is (11R,15S)-8-methyl-N-phenyl-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-5-amine.
| Compound Name | (11R,15S)-8-methyl-N-phenyl-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-5-amine |
|---|---|
| PubChem CID | 46240090 |
| Molecular Formula | C24H24F3N7 |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | (11R,15S)-8-methyl-N-phenyl-4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-5-amine |
| SMILES | CN1Cc2c(nn(Cc3ccc(C(F)(F)F)nc3)c2Nc2ccccc2)N2C1=N[C@@H]1CCC[C@@H]12 |
| InChI | InChI=1S/C24H24F3N7/c1-32-14-17-21(29-16-6-3-2-4-7-16)33(13-15-10-11-20(28-12-15)24(25,26)27)31-22(17)34-19-9-5-8-18(19)30-23(32)34/h2-4,6-7,10-12,18-19,29H,5,8-9,13-14H2,1H3/t18-,19+/m1/s1 |
| InChIKey | KYQOXIXVVVBLNU-MOPGFXCFSA-N |
| XLogP | 4.63 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |