C23H30O5 — CID 46240252
[(2S,4R,10R,14S,15R)-15-acetyl-10,14-dimethyl-7-oxo-3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-en-15-yl] acetate (PubChem CID 46240252) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is [(2S,4R,10R,14S,15R)-15-acetyl-10,14-dimethyl-7-oxo-3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-en-15-yl] acetate.
| Compound Name | [(2S,4R,10R,14S,15R)-15-acetyl-10,14-dimethyl-7-oxo-3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-en-15-yl] acetate |
|---|---|
| PubChem CID | 46240252 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | [(2S,4R,10R,14S,15R)-15-acetyl-10,14-dimethyl-7-oxo-3-oxapentacyclo[9.7.0.02,4.05,10.014,18]octadec-5-en-15-yl] acetate |
| SMILES | CC(=O)O[C@]1(C(C)=O)CCC2C3C(CC[C@@]21C)[C@@]1(C)CCC(=O)C=C1[C@H]1O[C@@H]31 |
| InChI | InChI=1S/C23H30O5/c1-12(24)23(28-13(2)25)10-7-16-18-15(6-9-22(16,23)4)21(3)8-5-14(26)11-17(21)19-20(18)27-19/h11,15-16,18-20H,5-10H2,1-4H3/t15?,16?,18?,19-,20+,21-,22+,23+/m1/s1 |
| InChIKey | HJWYHFCVJSNEOQ-OJSINQFYSA-N |
| XLogP | 3.40 |
| TPSA | 72.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|