C29H26N6O2S — CID 46240257
(11R,15S)-5-(benzenesulfinyl)-8-methyl-4-[(4-pyridin-2-ylphenyl)methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one (PubChem CID 46240257) has the molecular formula C29H26N6O2S and a molecular weight of 522.63 g/mol. Its IUPAC name is (11R,15S)-5-(benzenesulfinyl)-8-methyl-4-[(4-pyridin-2-ylphenyl)methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one.
| Compound Name | (11R,15S)-5-(benzenesulfinyl)-8-methyl-4-[(4-pyridin-2-ylphenyl)methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 46240257 |
| Molecular Formula | C29H26N6O2S |
| Molecular Weight | 522.63 g/mol |
| Exact Mass | 522.18 |
| IUPAC Name | (11R,15S)-5-(benzenesulfinyl)-8-methyl-4-[(4-pyridin-2-ylphenyl)methyl]-1,3,4,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
| SMILES | CN1C(=O)c2c(nn(Cc3ccc(-c4ccccn4)cc3)c2S(=O)c2ccccc2)N2C1=N[C@@H]1CCC[C@@H]12 |
| InChI | InChI=1S/C29H26N6O2S/c1-33-27(36)25-26(35-24-12-7-11-23(24)31-29(33)35)32-34(28(25)38(37)21-8-3-2-4-9-21)18-19-13-15-20(16-14-19)22-10-5-6-17-30-22/h2-6,8-10,13-17,23-24H,7,11-12,18H2,1H3/t23-,24+,38?/m1/s1 |
| InChIKey | QEELWFJFKKRUBM-IQGMXKCPSA-N |
| XLogP | 4.34 |
| TPSA | 83.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.63 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |