C19H23N5O3 — CID 46240487
6-[[2,6-dideuterio-4-methoxy-3,5-bis(trideuteriomethoxy)anilino]methyl]-5-(trideuteriomethyl)quinazoline-2,4-diamine (PubChem CID 46240487) has the molecular formula C19H23N5O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is 6-[[2,6-dideuterio-4-methoxy-3,5-bis(trideuteriomethoxy)anilino]methyl]-5-(trideuteriomethyl)quinazoline-2,4-diamine.
| Compound Name | 6-[[2,6-dideuterio-4-methoxy-3,5-bis(trideuteriomethoxy)anilino]methyl]-5-(trideuteriomethyl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 46240487 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | 6-[[2,6-dideuterio-4-methoxy-3,5-bis(trideuteriomethoxy)anilino]methyl]-5-(trideuteriomethyl)quinazoline-2,4-diamine |
| SMILES | [2H]c1c(NCc2ccc3nc(N)nc(N)c3c2C([2H])([2H])[2H])c([2H])c(OC([2H])([2H])[2H])c(OC)c1OC([2H])([2H])[2H] |
| InChI | InChI=1S/C19H23N5O3/c1-10-11(5-6-13-16(10)18(20)24-19(21)23-13)9-22-12-7-14(25-2)17(27-4)15(8-12)26-3/h5-8,22H,9H2,1-4H3,(H4,20,21,23,24)/i1D3,2D3,3D3,7D,8D |
| InChIKey | NOYPYLRCIDNJJB-OSVAIYKDSA-N |
| XLogP | 2.74 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|