C22H28N6O3 — CID 46240836
4-amino-2-butoxy-8-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]-5H-pteridine-6,7-dione (PubChem CID 46240836) has the molecular formula C22H28N6O3 and a molecular weight of 424.51 g/mol. Its IUPAC name is 4-amino-2-butoxy-8-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]-5H-pteridine-6,7-dione.
| Compound Name | 4-amino-2-butoxy-8-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]-5H-pteridine-6,7-dione |
|---|---|
| PubChem CID | 46240836 |
| Molecular Formula | C22H28N6O3 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 4-amino-2-butoxy-8-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]-5H-pteridine-6,7-dione |
| SMILES | CCCCOc1nc(N)c2[nH]c(=O)c(=O)n(Cc3ccc(CN4CCCC4)cc3)c2n1 |
| InChI | InChI=1S/C22H28N6O3/c1-2-3-12-31-22-25-18(23)17-19(26-22)28(21(30)20(29)24-17)14-16-8-6-15(7-9-16)13-27-10-4-5-11-27/h6-9H,2-5,10-14H2,1H3,(H,24,29)(H2,23,25,26) |
| InChIKey | QOMTZTSUSVQJGC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 119.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|