About 7-chloro-N-[3-[4-(3,5-dinitro-2-pyridinyl)piperazin-1-yl]propyl]quinolin-4-amine
7-chloro-N-[3-[4-(3,5-dinitro-2-pyridinyl)piperazin-1-yl]propyl]quinolin-4-amine (PubChem CID 46240842) has the molecular formula C21H22ClN7O4
and a molecular weight of 471.91 g/mol. Its IUPAC name is 7-chloro-N-[3-[4-(3,5-dinitro-2-pyridinyl)piperazin-1-yl]propyl]quinolin-4-amine.
Molecular Properties
| Compound Name | 7-chloro-N-[3-[4-(3,5-dinitro-2-pyridinyl)piperazin-1-yl]propyl]quinolin-4-amine |
| PubChem CID | 46240842 |
| Molecular Formula | C21H22ClN7O4 |
| Molecular Weight | 471.91 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 7-chloro-N-[3-[4-(3,5-dinitro-2-pyridinyl)piperazin-1-yl]propyl]quinolin-4-amine |
| SMILES | O=[N+]([O-])c1cnc(N2CCN(CCCNc3ccnc4cc(Cl)ccc34)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H22ClN7O4/c22-15-2-3-17-18(4-6-24-19(17)12-15)23-5-1-7-26-8-10-27(11-9-26)21-20(29(32)33)13-16(14-25-21)28(30)31/h2-4,6,12-14H,1,5,7-11H2,(H,23,24) |
| InChIKey | YTQNOPJEPYWJIY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 130.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.91 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-chloro-N-[3-[4-(3,5-dinitro-2-pyridinyl)piperazin-1-yl]propyl]quinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-N-[3-[4-(3,5-dinitro-2-pyridinyl)piperazin-1-yl]propyl]quinolin-4-amine?
The IUPAC name of 7-chloro-N-[3-[4-(3,5-dinitro-2-pyridinyl)piperazin-1-yl]propyl]quinolin-4-amine (CID 46240842) is 7-chloro-N-[3-[4-(3,5-dinitro-2-pyridinyl)piperazin-1-yl]propyl]quinolin-4-amine.
What is the SMILES notation for 7-chloro-N-[3-[4-(3,5-dinitro-2-pyridinyl)piperazin-1-yl]propyl]quinolin-4-amine?
The canonical SMILES for 7-chloro-N-[3-[4-(3,5-dinitro-2-pyridinyl)piperazin-1-yl]propyl]quinolin-4-amine is O=[N+]([O-])c1cnc(N2CCN(CCCNc3ccnc4cc(Cl)ccc34)CC2)c([N+](=O)[O-])c1.
What is the InChIKey of 7-chloro-N-[3-[4-(3,5-dinitro-2-pyridinyl)piperazin-1-yl]propyl]quinolin-4-amine?
The InChIKey is YTQNOPJEPYWJIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22ClN7O4/c22-15-2-3-17-18(4-6-24-19(17)12-15)23-5-1-7-26-8-10-27(11-9-26)21-20(29(32)33)13-16(14-25-21)28(30)31/h2-4,6,12-14H,1,5,7-11H2,(H,23,24).
What are the key properties of 7-chloro-N-[3-[4-(3,5-dinitro-2-pyridinyl)piperazin-1-yl]propyl]quinolin-4-amine?
7-chloro-N-[3-[4-(3,5-dinitro-2-pyridinyl)piperazin-1-yl]propyl]quinolin-4-amine has a molecular weight of 471.91 g/mol, XLogP of 3.72, 8 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-N-[3-[4-(3,5-dinitro-2-pyridinyl)piperazin-1-yl]propyl]quinolin-4-amine is sourced from PubChem (CID 46240842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).