About 5-bromopentanimidamide
5-bromopentanimidamide (PubChem CID 4624160) has the molecular formula C5H11BrN2
and a molecular weight of 179.06 g/mol. Its IUPAC name is 5-bromopentanimidamide.
Molecular Properties
| Compound Name | 5-bromopentanimidamide |
| PubChem CID | 4624160 |
| Molecular Formula | C5H11BrN2 |
| Molecular Weight | 179.06 g/mol |
| Exact Mass | 178.01 |
| IUPAC Name | 5-bromopentanimidamide |
| SMILES | [H]/N=C(/N)CCCCBr |
| InChI | InChI=1S/C5H11BrN2/c6-4-2-1-3-5(7)8/h1-4H2,(H3,7,8) |
| InChIKey | NVSZRILZXPKLDQ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.06 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-bromopentanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromopentanimidamide?
The IUPAC name of 5-bromopentanimidamide (CID 4624160) is 5-bromopentanimidamide.
What is the SMILES notation for 5-bromopentanimidamide?
The canonical SMILES for 5-bromopentanimidamide is [H]/N=C(/N)CCCCBr.
What is the InChIKey of 5-bromopentanimidamide?
The InChIKey is NVSZRILZXPKLDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11BrN2/c6-4-2-1-3-5(7)8/h1-4H2,(H3,7,8).
What are the key properties of 5-bromopentanimidamide?
5-bromopentanimidamide has a molecular weight of 179.06 g/mol, XLogP of 1.49, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromopentanimidamide is sourced from PubChem (CID 4624160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).