C16H18N4O2 — CID 46241898
N-(2-methoxyethyl)-3-(3-methoxyphenyl)imidazo[1,2-a]pyrazin-8-amine (PubChem CID 46241898) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-(3-methoxyphenyl)imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | N-(2-methoxyethyl)-3-(3-methoxyphenyl)imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 46241898 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | N-(2-methoxyethyl)-3-(3-methoxyphenyl)imidazo[1,2-a]pyrazin-8-amine |
| SMILES | COCCNc1nccn2c(-c3cccc(OC)c3)cnc12 |
| InChI | InChI=1S/C16H18N4O2/c1-21-9-7-18-15-16-19-11-14(20(16)8-6-17-15)12-4-3-5-13(10-12)22-2/h3-6,8,10-11H,7,9H2,1-2H3,(H,17,18) |
| InChIKey | DFJQFBXVILQNOE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|