C24H27F3N4O4 — CID 46241942
3,4,5-trifluoro-N-[2-[[1-[4-hydroxy-4-(6-methoxy-3-pyridinyl)cyclohexyl]azetidin-3-yl]amino]-2-oxoethyl]benzamide (PubChem CID 46241942) has the molecular formula C24H27F3N4O4 and a molecular weight of 492.50 g/mol. Its IUPAC name is 3,4,5-trifluoro-N-[2-[[1-[4-hydroxy-4-(6-methoxy-3-pyridinyl)cyclohexyl]azetidin-3-yl]amino]-2-oxoethyl]benzamide.
| Compound Name | 3,4,5-trifluoro-N-[2-[[1-[4-hydroxy-4-(6-methoxy-3-pyridinyl)cyclohexyl]azetidin-3-yl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 46241942 |
| Molecular Formula | C24H27F3N4O4 |
| Molecular Weight | 492.50 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 3,4,5-trifluoro-N-[2-[[1-[4-hydroxy-4-(6-methoxy-3-pyridinyl)cyclohexyl]azetidin-3-yl]amino]-2-oxoethyl]benzamide |
| SMILES | COc1ccc(C2(O)CCC(N3CC(NC(=O)CNC(=O)c4cc(F)c(F)c(F)c4)C3)CC2)cn1 |
| InChI | InChI=1S/C24H27F3N4O4/c1-35-21-3-2-15(10-28-21)24(34)6-4-17(5-7-24)31-12-16(13-31)30-20(32)11-29-23(33)14-8-18(25)22(27)19(26)9-14/h2-3,8-10,16-17,34H,4-7,11-13H2,1H3,(H,29,33)(H,30,32) |
| InChIKey | DGOWUOWXZUVMTI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.50 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|