About (3R)-3-[(E,2S)-4-(4-chlorophenyl)-1-nitrobut-3-en-2-yl]oxan-4-one
(3R)-3-[(E,2S)-4-(4-chlorophenyl)-1-nitrobut-3-en-2-yl]oxan-4-one (PubChem CID 46242027) has the molecular formula C15H16ClNO4
and a molecular weight of 309.75 g/mol. Its IUPAC name is (3R)-3-[(E,2S)-4-(4-chlorophenyl)-1-nitrobut-3-en-2-yl]oxan-4-one.
Molecular Properties
| Compound Name | (3R)-3-[(E,2S)-4-(4-chlorophenyl)-1-nitrobut-3-en-2-yl]oxan-4-one |
| PubChem CID | 46242027 |
| Molecular Formula | C15H16ClNO4 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | (3R)-3-[(E,2S)-4-(4-chlorophenyl)-1-nitrobut-3-en-2-yl]oxan-4-one |
| SMILES | O=C1CCOC[C@H]1[C@H](/C=C/c1ccc(Cl)cc1)C[N+](=O)[O-] |
| InChI | InChI=1S/C15H16ClNO4/c16-13-5-2-11(3-6-13)1-4-12(9-17(19)20)14-10-21-8-7-15(14)18/h1-6,12,14H,7-10H2/b4-1+/t12-,14+/m1/s1 |
| InChIKey | RHLMZIAHBZJYGM-REUWEECFSA-N |
| XLogP | 2.85 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3-[(E,2S)-4-(4-chlorophenyl)-1-nitrobut-3-en-2-yl]oxan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-[(E,2S)-4-(4-chlorophenyl)-1-nitrobut-3-en-2-yl]oxan-4-one?
The IUPAC name of (3R)-3-[(E,2S)-4-(4-chlorophenyl)-1-nitrobut-3-en-2-yl]oxan-4-one (CID 46242027) is (3R)-3-[(E,2S)-4-(4-chlorophenyl)-1-nitrobut-3-en-2-yl]oxan-4-one.
What is the SMILES notation for (3R)-3-[(E,2S)-4-(4-chlorophenyl)-1-nitrobut-3-en-2-yl]oxan-4-one?
The canonical SMILES for (3R)-3-[(E,2S)-4-(4-chlorophenyl)-1-nitrobut-3-en-2-yl]oxan-4-one is O=C1CCOC[C@H]1[C@H](/C=C/c1ccc(Cl)cc1)C[N+](=O)[O-].
What is the InChIKey of (3R)-3-[(E,2S)-4-(4-chlorophenyl)-1-nitrobut-3-en-2-yl]oxan-4-one?
The InChIKey is RHLMZIAHBZJYGM-REUWEECFSA-N. The full InChI is InChI=1S/C15H16ClNO4/c16-13-5-2-11(3-6-13)1-4-12(9-17(19)20)14-10-21-8-7-15(14)18/h1-6,12,14H,7-10H2/b4-1+/t12-,14+/m1/s1.
What are the key properties of (3R)-3-[(E,2S)-4-(4-chlorophenyl)-1-nitrobut-3-en-2-yl]oxan-4-one?
(3R)-3-[(E,2S)-4-(4-chlorophenyl)-1-nitrobut-3-en-2-yl]oxan-4-one has a molecular weight of 309.75 g/mol, XLogP of 2.85, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-[(E,2S)-4-(4-chlorophenyl)-1-nitrobut-3-en-2-yl]oxan-4-one is sourced from PubChem (CID 46242027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).