C26H40ClNO3 — CID 46242511
(E,7S)-N-[(Z)-3-chloro-2-(2-hydroxy-3-methylphenyl)prop-2-enyl]-7-methoxy-N-methyltetradec-4-enamide (PubChem CID 46242511) has the molecular formula C26H40ClNO3 and a molecular weight of 450.06 g/mol. Its IUPAC name is (E,7S)-N-[(Z)-3-chloro-2-(2-hydroxy-3-methylphenyl)prop-2-enyl]-7-methoxy-N-methyltetradec-4-enamide.
| Compound Name | (E,7S)-N-[(Z)-3-chloro-2-(2-hydroxy-3-methylphenyl)prop-2-enyl]-7-methoxy-N-methyltetradec-4-enamide |
|---|---|
| PubChem CID | 46242511 |
| Molecular Formula | C26H40ClNO3 |
| Molecular Weight | 450.06 g/mol |
| Exact Mass | 449.27 |
| IUPAC Name | (E,7S)-N-[(Z)-3-chloro-2-(2-hydroxy-3-methylphenyl)prop-2-enyl]-7-methoxy-N-methyltetradec-4-enamide |
| SMILES | CCCCCCC[C@@H](C/C=C/CCC(=O)N(C)C/C(=C\Cl)c1cccc(C)c1O)OC |
| InChI | InChI=1S/C26H40ClNO3/c1-5-6-7-8-10-15-23(31-4)16-11-9-12-18-25(29)28(3)20-22(19-27)24-17-13-14-21(2)26(24)30/h9,11,13-14,17,19,23,30H,5-8,10,12,15-16,18,20H2,1-4H3/b11-9+,22-19+/t23-/m0/s1 |
| InChIKey | ONLRPLDTZJYMBK-UJRRINNZSA-N |
| XLogP | 6.84 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.06 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|