C26H23NO4 — CID 46242630
1,3-bis(4-methoxyphenyl)-2,3-dihydro-1H-benzo[de]isoquinoline-4,9-diol (PubChem CID 46242630) has the molecular formula C26H23NO4 and a molecular weight of 413.47 g/mol. Its IUPAC name is 1,3-bis(4-methoxyphenyl)-2,3-dihydro-1H-benzo[de]isoquinoline-4,9-diol.
| Compound Name | 1,3-bis(4-methoxyphenyl)-2,3-dihydro-1H-benzo[de]isoquinoline-4,9-diol |
|---|---|
| PubChem CID | 46242630 |
| Molecular Formula | C26H23NO4 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 1,3-bis(4-methoxyphenyl)-2,3-dihydro-1H-benzo[de]isoquinoline-4,9-diol |
| SMILES | COc1ccc(C2NC(c3ccc(OC)cc3)c3c(O)ccc4ccc(O)c2c34)cc1 |
| InChI | InChI=1S/C26H23NO4/c1-30-18-9-3-16(4-10-18)25-23-20(28)13-7-15-8-14-21(29)24(22(15)23)26(27-25)17-5-11-19(31-2)12-6-17/h3-14,25-29H,1-2H3 |
| InChIKey | MCXJLEZDTLCFES-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|