C21H38O3Si — CID 46243244
(1S,2R,5S,8R,10R)-1,5-dimethyl-8-propan-2-yl-5-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undec-6-en-10-ol (PubChem CID 46243244) has the molecular formula C21H38O3Si and a molecular weight of 366.62 g/mol. Its IUPAC name is (1S,2R,5S,8R,10R)-1,5-dimethyl-8-propan-2-yl-5-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undec-6-en-10-ol.
| Compound Name | (1S,2R,5S,8R,10R)-1,5-dimethyl-8-propan-2-yl-5-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undec-6-en-10-ol |
|---|---|
| PubChem CID | 46243244 |
| Molecular Formula | C21H38O3Si |
| Molecular Weight | 366.62 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | (1S,2R,5S,8R,10R)-1,5-dimethyl-8-propan-2-yl-5-triethylsilyloxy-11-oxatricyclo[6.2.1.02,6]undec-6-en-10-ol |
| SMILES | CC[Si](CC)(CC)O[C@@]1(C)CC[C@@H]2C1=C[C@]1(C(C)C)C[C@@H](O)[C@@]2(C)O1 |
| InChI | InChI=1S/C21H38O3Si/c1-8-25(9-2,10-3)24-19(6)12-11-16-17(19)13-21(15(4)5)14-18(22)20(16,7)23-21/h13,15-16,18,22H,8-12,14H2,1-7H3/t16-,18-,19+,20+,21-/m1/s1 |
| InChIKey | FKPQAHOLNCSPSP-BVJIBDCISA-N |
| XLogP | 5.05 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.62 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|