C21H38O3Si — CID 46243245
(1S,2R,5S,8R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undec-6-en-5-ol (PubChem CID 46243245) has the molecular formula C21H38O3Si and a molecular weight of 366.62 g/mol. Its IUPAC name is (1S,2R,5S,8R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undec-6-en-5-ol.
| Compound Name | (1S,2R,5S,8R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undec-6-en-5-ol |
|---|---|
| PubChem CID | 46243245 |
| Molecular Formula | C21H38O3Si |
| Molecular Weight | 366.62 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | (1S,2R,5S,8R,10R)-10-[tert-butyl(dimethyl)silyl]oxy-1,5-dimethyl-8-propan-2-yl-11-oxatricyclo[6.2.1.02,6]undec-6-en-5-ol |
| SMILES | CC(C)[C@]12C=C3[C@@H](CC[C@]3(C)O)[C@](C)(O1)[C@H](O[Si](C)(C)C(C)(C)C)C2 |
| InChI | InChI=1S/C21H38O3Si/c1-14(2)21-12-16-15(10-11-19(16,6)22)20(7,24-21)17(13-21)23-25(8,9)18(3,4)5/h12,14-15,17,22H,10-11,13H2,1-9H3/t15-,17-,19+,20+,21-/m1/s1 |
| InChIKey | GPFBHPGWMNWVNZ-NIAVFTRYSA-N |
| XLogP | 5.05 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.62 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|