C23H27BF2N2O — CID 46243272
4-(5,11-diethyl-2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)phenol (PubChem CID 46243272) has the molecular formula C23H27BF2N2O and a molecular weight of 396.29 g/mol. Its IUPAC name is 4-(5,11-diethyl-2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)phenol.
| Compound Name | 4-(5,11-diethyl-2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)phenol |
|---|---|
| PubChem CID | 46243272 |
| Molecular Formula | C23H27BF2N2O |
| Molecular Weight | 396.29 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | 4-(5,11-diethyl-2,2-difluoro-4,6,10,12-tetramethyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaen-8-yl)phenol |
| SMILES | CCC1=C(C)C2=C(c3ccc(O)cc3)c3c(C)c(CC)c(C)n3[B-](F)(F)[N+]2=C1C |
| InChI | InChI=1S/C23H27BF2N2O/c1-7-19-13(3)22-21(17-9-11-18(29)12-10-17)23-14(4)20(8-2)16(6)28(23)24(25,26)27(22)15(19)5/h9-12,29H,7-8H2,1-6H3 |
| InChIKey | IJNMBBDVVRNJMJ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 28.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.29 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|