C26H38O6 — CID 46243503
[[(3aR,5R,6R,6aR)-6-ethenyl-6-methoxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]-[(3S,5R)-5-ethenyl-6,6-dimethyl-3-prop-1-en-2-ylcyclohexen-1-yl]methyl] acetate (PubChem CID 46243503) has the molecular formula C26H38O6 and a molecular weight of 446.58 g/mol. Its IUPAC name is [[(3aR,5R,6R,6aR)-6-ethenyl-6-methoxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]-[(3S,5R)-5-ethenyl-6,6-dimethyl-3-prop-1-en-2-ylcyclohexen-1-yl]methyl] acetate.
| Compound Name | [[(3aR,5R,6R,6aR)-6-ethenyl-6-methoxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]-[(3S,5R)-5-ethenyl-6,6-dimethyl-3-prop-1-en-2-ylcyclohexen-1-yl]methyl] acetate |
|---|---|
| PubChem CID | 46243503 |
| Molecular Formula | C26H38O6 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | [[(3aR,5R,6R,6aR)-6-ethenyl-6-methoxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]-[(3S,5R)-5-ethenyl-6,6-dimethyl-3-prop-1-en-2-ylcyclohexen-1-yl]methyl] acetate |
| SMILES | C=C[C@H]1C[C@H](C(=C)C)C=C(C(OC(C)=O)[C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@]2(C=C)OC)C1(C)C |
| InChI | InChI=1S/C26H38O6/c1-11-18-13-17(15(3)4)14-19(24(18,6)7)20(29-16(5)27)21-26(12-2,28-10)22-23(30-21)32-25(8,9)31-22/h11-12,14,17-18,20-23H,1-3,13H2,4-10H3/t17-,18-,20?,21+,22-,23+,26+/m0/s1 |
| InChIKey | WNQUIOGRHFJXGO-AXAOPKOTSA-N |
| XLogP | 4.72 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|