C36H24FeN10S4 — CID 46243645
bis(N-(4,5-diphenyl-1H-pyrazolo[3,4-c]pyridazin-3-yl)carbamodithioate);iron(2+) (PubChem CID 46243645) has the molecular formula C36H24FeN10S4 and a molecular weight of 780.77 g/mol. Its IUPAC name is bis(N-(4,5-diphenyl-1H-pyrazolo[3,4-c]pyridazin-3-yl)carbamodithioate);iron(2+).
| Compound Name | bis(N-(4,5-diphenyl-1H-pyrazolo[3,4-c]pyridazin-3-yl)carbamodithioate);iron(2+) |
|---|---|
| PubChem CID | 46243645 |
| Molecular Formula | C36H24FeN10S4 |
| Molecular Weight | 780.77 g/mol |
| Exact Mass | 780.04 |
| IUPAC Name | bis(N-(4,5-diphenyl-1H-pyrazolo[3,4-c]pyridazin-3-yl)carbamodithioate);iron(2+) |
| SMILES | S=C([S-])Nc1n[nH]c2nnc(-c3ccccc3)c(-c3ccccc3)c12.S=C([S-])Nc1n[nH]c2nnc(-c3ccccc3)c(-c3ccccc3)c12.[Fe+2] |
| InChI | InChI=1S/2C18H13N5S2.Fe/c2*24-18(25)19-16-14-13(11-7-3-1-4-8-11)15(12-9-5-2-6-10-12)20-22-17(14)23-21-16;/h2*1-10H,(H3,19,21,22,23,24,25);/q;;+2/p-2 |
| InChIKey | KRYLFEOVXONDGB-UHFFFAOYSA-L |
| XLogP | 7.86 |
| TPSA | 132.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.77 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|