About cis-(2S,4S)-4-tert-butyl-2-[(E,2S)-1-nitro-4-phenylbut-3-en-2-yl]cyclohexan-1-one
cis-(2S,4S)-4-tert-butyl-2-[(E,2S)-1-nitro-4-phenylbut-3-en-2-yl]cyclohexan-1-one (PubChem CID 46243714) has the molecular formula C20H27NO3
and a molecular weight of 329.44 g/mol. Its IUPAC name is cis-(2S,4S)-4-tert-butyl-2-[(E,2S)-1-nitro-4-phenylbut-3-en-2-yl]cyclohexan-1-one.
Molecular Properties
| Compound Name | cis-(2S,4S)-4-tert-butyl-2-[(E,2S)-1-nitro-4-phenylbut-3-en-2-yl]cyclohexan-1-one |
| PubChem CID | 46243714 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | cis-(2S,4S)-4-tert-butyl-2-[(E,2S)-1-nitro-4-phenylbut-3-en-2-yl]cyclohexan-1-one |
| SMILES | CC(C)(C)[C@H]1CCC(=O)[C@H]([C@H](/C=C/c2ccccc2)C[N+](=O)[O-])C1 |
| InChI | InChI=1S/C20H27NO3/c1-20(2,3)17-11-12-19(22)18(13-17)16(14-21(23)24)10-9-15-7-5-4-6-8-15/h4-10,16-18H,11-14H2,1-3H3/b10-9+/t16-,17+,18+/m1/s1 |
| InChIKey | BNUBGRDZBUIZKG-JZDUDEBISA-N |
| XLogP | 4.62 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze cis-(2S,4S)-4-tert-butyl-2-[(E,2S)-1-nitro-4-phenylbut-3-en-2-yl]cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(2S,4S)-4-tert-butyl-2-[(E,2S)-1-nitro-4-phenylbut-3-en-2-yl]cyclohexan-1-one?
The IUPAC name of cis-(2S,4S)-4-tert-butyl-2-[(E,2S)-1-nitro-4-phenylbut-3-en-2-yl]cyclohexan-1-one (CID 46243714) is cis-(2S,4S)-4-tert-butyl-2-[(E,2S)-1-nitro-4-phenylbut-3-en-2-yl]cyclohexan-1-one.
What is the SMILES notation for cis-(2S,4S)-4-tert-butyl-2-[(E,2S)-1-nitro-4-phenylbut-3-en-2-yl]cyclohexan-1-one?
The canonical SMILES for cis-(2S,4S)-4-tert-butyl-2-[(E,2S)-1-nitro-4-phenylbut-3-en-2-yl]cyclohexan-1-one is CC(C)(C)[C@H]1CCC(=O)[C@H]([C@H](/C=C/c2ccccc2)C[N+](=O)[O-])C1.
What is the InChIKey of cis-(2S,4S)-4-tert-butyl-2-[(E,2S)-1-nitro-4-phenylbut-3-en-2-yl]cyclohexan-1-one?
The InChIKey is BNUBGRDZBUIZKG-JZDUDEBISA-N. The full InChI is InChI=1S/C20H27NO3/c1-20(2,3)17-11-12-19(22)18(13-17)16(14-21(23)24)10-9-15-7-5-4-6-8-15/h4-10,16-18H,11-14H2,1-3H3/b10-9+/t16-,17+,18+/m1/s1.
What are the key properties of cis-(2S,4S)-4-tert-butyl-2-[(E,2S)-1-nitro-4-phenylbut-3-en-2-yl]cyclohexan-1-one?
cis-(2S,4S)-4-tert-butyl-2-[(E,2S)-1-nitro-4-phenylbut-3-en-2-yl]cyclohexan-1-one has a molecular weight of 329.44 g/mol, XLogP of 4.62, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(2S,4S)-4-tert-butyl-2-[(E,2S)-1-nitro-4-phenylbut-3-en-2-yl]cyclohexan-1-one is sourced from PubChem (CID 46243714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).