About 2-[2-[(3S)-3-(3,4-dichlorophenyl)piperidin-3-yl]ethylamino]ethanol
2-[2-[(3S)-3-(3,4-dichlorophenyl)piperidin-3-yl]ethylamino]ethanol (PubChem CID 46243969) has the molecular formula C15H22Cl2N2O
and a molecular weight of 317.26 g/mol. Its IUPAC name is 2-[2-[(3S)-3-(3,4-dichlorophenyl)piperidin-3-yl]ethylamino]ethanol.
Molecular Properties
| Compound Name | 2-[2-[(3S)-3-(3,4-dichlorophenyl)piperidin-3-yl]ethylamino]ethanol |
| PubChem CID | 46243969 |
| Molecular Formula | C15H22Cl2N2O |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 2-[2-[(3S)-3-(3,4-dichlorophenyl)piperidin-3-yl]ethylamino]ethanol |
| SMILES | OCCNCC[C@]1(c2ccc(Cl)c(Cl)c2)CCCNC1 |
| InChI | InChI=1S/C15H22Cl2N2O/c16-13-3-2-12(10-14(13)17)15(4-1-6-19-11-15)5-7-18-8-9-20/h2-3,10,18-20H,1,4-9,11H2/t15-/m1/s1 |
| InChIKey | ZQOOXLSPBJTULW-OAHLLOKOSA-N |
| XLogP | 2.59 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[(3S)-3-(3,4-dichlorophenyl)piperidin-3-yl]ethylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[(3S)-3-(3,4-dichlorophenyl)piperidin-3-yl]ethylamino]ethanol?
The IUPAC name of 2-[2-[(3S)-3-(3,4-dichlorophenyl)piperidin-3-yl]ethylamino]ethanol (CID 46243969) is 2-[2-[(3S)-3-(3,4-dichlorophenyl)piperidin-3-yl]ethylamino]ethanol.
What is the SMILES notation for 2-[2-[(3S)-3-(3,4-dichlorophenyl)piperidin-3-yl]ethylamino]ethanol?
The canonical SMILES for 2-[2-[(3S)-3-(3,4-dichlorophenyl)piperidin-3-yl]ethylamino]ethanol is OCCNCC[C@]1(c2ccc(Cl)c(Cl)c2)CCCNC1.
What is the InChIKey of 2-[2-[(3S)-3-(3,4-dichlorophenyl)piperidin-3-yl]ethylamino]ethanol?
The InChIKey is ZQOOXLSPBJTULW-OAHLLOKOSA-N. The full InChI is InChI=1S/C15H22Cl2N2O/c16-13-3-2-12(10-14(13)17)15(4-1-6-19-11-15)5-7-18-8-9-20/h2-3,10,18-20H,1,4-9,11H2/t15-/m1/s1.
What are the key properties of 2-[2-[(3S)-3-(3,4-dichlorophenyl)piperidin-3-yl]ethylamino]ethanol?
2-[2-[(3S)-3-(3,4-dichlorophenyl)piperidin-3-yl]ethylamino]ethanol has a molecular weight of 317.26 g/mol, XLogP of 2.59, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[(3S)-3-(3,4-dichlorophenyl)piperidin-3-yl]ethylamino]ethanol is sourced from PubChem (CID 46243969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).