C16H11F3N2O — CID 46244165
9-(trifluoromethyl)-1,2,4,7-tetrahydropyrido[2,3-c]carbazol-3-one (PubChem CID 46244165) has the molecular formula C16H11F3N2O and a molecular weight of 304.27 g/mol. Its IUPAC name is 9-(trifluoromethyl)-1,2,4,7-tetrahydropyrido[2,3-c]carbazol-3-one.
| Compound Name | 9-(trifluoromethyl)-1,2,4,7-tetrahydropyrido[2,3-c]carbazol-3-one |
|---|---|
| PubChem CID | 46244165 |
| Molecular Formula | C16H11F3N2O |
| Molecular Weight | 304.27 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 9-(trifluoromethyl)-1,2,4,7-tetrahydropyrido[2,3-c]carbazol-3-one |
| SMILES | O=C1CCc2c(ccc3[nH]c4cc(C(F)(F)F)ccc4c23)N1 |
| InChI | InChI=1S/C16H11F3N2O/c17-16(18,19)8-1-2-10-13(7-8)20-12-5-4-11-9(15(10)12)3-6-14(22)21-11/h1-2,4-5,7,20H,3,6H2,(H,21,22) |
| InChIKey | LMJKWSNXAALLFE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.27 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |