About 3-amino-N-[5-(3,5-difluorophenoxy)-1H-indazol-3-yl]benzamide
3-amino-N-[5-(3,5-difluorophenoxy)-1H-indazol-3-yl]benzamide (PubChem CID 46244215) has the molecular formula C20H14F2N4O2
and a molecular weight of 380.35 g/mol. Its IUPAC name is 3-amino-N-[5-(3,5-difluorophenoxy)-1H-indazol-3-yl]benzamide.
Molecular Properties
| Compound Name | 3-amino-N-[5-(3,5-difluorophenoxy)-1H-indazol-3-yl]benzamide |
| PubChem CID | 46244215 |
| Molecular Formula | C20H14F2N4O2 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 3-amino-N-[5-(3,5-difluorophenoxy)-1H-indazol-3-yl]benzamide |
| SMILES | Nc1cccc(C(=O)Nc2n[nH]c3ccc(Oc4cc(F)cc(F)c4)cc23)c1 |
| InChI | InChI=1S/C20H14F2N4O2/c21-12-7-13(22)9-16(8-12)28-15-4-5-18-17(10-15)19(26-25-18)24-20(27)11-2-1-3-14(23)6-11/h1-10H,23H2,(H2,24,25,26,27) |
| InChIKey | REXBVNPEPFUDKK-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-N-[5-(3,5-difluorophenoxy)-1H-indazol-3-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-[5-(3,5-difluorophenoxy)-1H-indazol-3-yl]benzamide?
The IUPAC name of 3-amino-N-[5-(3,5-difluorophenoxy)-1H-indazol-3-yl]benzamide (CID 46244215) is 3-amino-N-[5-(3,5-difluorophenoxy)-1H-indazol-3-yl]benzamide.
What is the SMILES notation for 3-amino-N-[5-(3,5-difluorophenoxy)-1H-indazol-3-yl]benzamide?
The canonical SMILES for 3-amino-N-[5-(3,5-difluorophenoxy)-1H-indazol-3-yl]benzamide is Nc1cccc(C(=O)Nc2n[nH]c3ccc(Oc4cc(F)cc(F)c4)cc23)c1.
What is the InChIKey of 3-amino-N-[5-(3,5-difluorophenoxy)-1H-indazol-3-yl]benzamide?
The InChIKey is REXBVNPEPFUDKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14F2N4O2/c21-12-7-13(22)9-16(8-12)28-15-4-5-18-17(10-15)19(26-25-18)24-20(27)11-2-1-3-14(23)6-11/h1-10H,23H2,(H2,24,25,26,27).
What are the key properties of 3-amino-N-[5-(3,5-difluorophenoxy)-1H-indazol-3-yl]benzamide?
3-amino-N-[5-(3,5-difluorophenoxy)-1H-indazol-3-yl]benzamide has a molecular weight of 380.35 g/mol, XLogP of 4.47, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-[5-(3,5-difluorophenoxy)-1H-indazol-3-yl]benzamide is sourced from PubChem (CID 46244215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).