C20H15Cl2F3N4O3S — CID 46244602
N-[2-[cyano(methyl)amino]-2-oxoethyl]-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-3-methylthiophene-2-carboxamide (PubChem CID 46244602) has the molecular formula C20H15Cl2F3N4O3S and a molecular weight of 519.33 g/mol. Its IUPAC name is N-[2-[cyano(methyl)amino]-2-oxoethyl]-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-3-methylthiophene-2-carboxamide.
| Compound Name | N-[2-[cyano(methyl)amino]-2-oxoethyl]-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-3-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 46244602 |
| Molecular Formula | C20H15Cl2F3N4O3S |
| Molecular Weight | 519.33 g/mol |
| Exact Mass | 518.02 |
| IUPAC Name | N-[2-[cyano(methyl)amino]-2-oxoethyl]-5-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-3-methylthiophene-2-carboxamide |
| SMILES | Cc1cc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)sc1C(=O)NCC(=O)N(C)C#N |
| InChI | InChI=1S/C20H15Cl2F3N4O3S/c1-10-3-15(33-17(10)18(31)27-8-16(30)29(2)9-26)14-7-19(32-28-14,20(23,24)25)11-4-12(21)6-13(22)5-11/h3-6H,7-8H2,1-2H3,(H,27,31) |
| InChIKey | OWCGPTMZBZPJKY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 94.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.33 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|