C15H18FN3O3 — CID 46244970
7-butyl-8-(fluoromethyl)-3-prop-2-enyl-1H-pyrido[2,3-d]pyrimidine-2,4,5-trione (PubChem CID 46244970) has the molecular formula C15H18FN3O3 and a molecular weight of 307.33 g/mol. Its IUPAC name is 7-butyl-8-(fluoromethyl)-3-prop-2-enyl-1H-pyrido[2,3-d]pyrimidine-2,4,5-trione.
| Compound Name | 7-butyl-8-(fluoromethyl)-3-prop-2-enyl-1H-pyrido[2,3-d]pyrimidine-2,4,5-trione |
|---|---|
| PubChem CID | 46244970 |
| Molecular Formula | C15H18FN3O3 |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 7-butyl-8-(fluoromethyl)-3-prop-2-enyl-1H-pyrido[2,3-d]pyrimidine-2,4,5-trione |
| SMILES | C=CCn1c(=O)[nH]c2c(c(=O)cc(CCCC)n2CF)c1=O |
| InChI | InChI=1S/C15H18FN3O3/c1-3-5-6-10-8-11(20)12-13(19(10)9-16)17-15(22)18(7-4-2)14(12)21/h4,8H,2-3,5-7,9H2,1H3,(H,17,22) |
| InChIKey | ZCBLAAPQDCKBCK-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|