C16H19F2N3O3 — CID 46245054
7-butyl-8-(2,2-difluoroethyl)-3-prop-2-enyl-1H-pyrido[2,3-d]pyrimidine-2,4,5-trione (PubChem CID 46245054) has the molecular formula C16H19F2N3O3 and a molecular weight of 339.34 g/mol. Its IUPAC name is 7-butyl-8-(2,2-difluoroethyl)-3-prop-2-enyl-1H-pyrido[2,3-d]pyrimidine-2,4,5-trione.
| Compound Name | 7-butyl-8-(2,2-difluoroethyl)-3-prop-2-enyl-1H-pyrido[2,3-d]pyrimidine-2,4,5-trione |
|---|---|
| PubChem CID | 46245054 |
| Molecular Formula | C16H19F2N3O3 |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 7-butyl-8-(2,2-difluoroethyl)-3-prop-2-enyl-1H-pyrido[2,3-d]pyrimidine-2,4,5-trione |
| SMILES | C=CCn1c(=O)[nH]c2c(c(=O)cc(CCCC)n2CC(F)F)c1=O |
| InChI | InChI=1S/C16H19F2N3O3/c1-3-5-6-10-8-11(22)13-14(21(10)9-12(17)18)19-16(24)20(7-4-2)15(13)23/h4,8,12H,2-3,5-7,9H2,1H3,(H,19,24) |
| InChIKey | PRYWGLSJKWQAJL-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 76.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|