C12H18O2 — CID 46245445
[(1R,6S,7R)-6-methyl-8-oxatricyclo[5.2.2.01,6]undec-2-en-2-yl]methanol (PubChem CID 46245445) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is [(1R,6S,7R)-6-methyl-8-oxatricyclo[5.2.2.01,6]undec-2-en-2-yl]methanol.
| Compound Name | [(1R,6S,7R)-6-methyl-8-oxatricyclo[5.2.2.01,6]undec-2-en-2-yl]methanol |
|---|---|
| PubChem CID | 46245445 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | [(1R,6S,7R)-6-methyl-8-oxatricyclo[5.2.2.01,6]undec-2-en-2-yl]methanol |
| SMILES | C[C@]12CCC=C(CO)[C@]13CC[C@H]2OC3 |
| InChI | InChI=1S/C12H18O2/c1-11-5-2-3-9(7-13)12(11)6-4-10(11)14-8-12/h3,10,13H,2,4-8H2,1H3/t10-,11-,12-/m1/s1 |
| InChIKey | NQSNUWBVTYFOHK-IJLUTSLNSA-N |
| XLogP | 1.88 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|