C23H26ClN3O3 — CID 46246167
1-[2-(5-chloro-2-hydroxyphenyl)-4-(4-methoxyphenyl)-1,5,9-triazaspiro[5.5]undec-4-en-9-yl]ethanone (PubChem CID 46246167) has the molecular formula C23H26ClN3O3 and a molecular weight of 427.93 g/mol. Its IUPAC name is 1-[2-(5-chloro-2-hydroxyphenyl)-4-(4-methoxyphenyl)-1,5,9-triazaspiro[5.5]undec-4-en-9-yl]ethanone.
| Compound Name | 1-[2-(5-chloro-2-hydroxyphenyl)-4-(4-methoxyphenyl)-1,5,9-triazaspiro[5.5]undec-4-en-9-yl]ethanone |
|---|---|
| PubChem CID | 46246167 |
| Molecular Formula | C23H26ClN3O3 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 1-[2-(5-chloro-2-hydroxyphenyl)-4-(4-methoxyphenyl)-1,5,9-triazaspiro[5.5]undec-4-en-9-yl]ethanone |
| SMILES | COc1ccc(C2=NC3(CCN(C(C)=O)CC3)NC(c3cc(Cl)ccc3O)C2)cc1 |
| InChI | InChI=1S/C23H26ClN3O3/c1-15(28)27-11-9-23(10-12-27)25-20(16-3-6-18(30-2)7-4-16)14-21(26-23)19-13-17(24)5-8-22(19)29/h3-8,13,21,26,29H,9-12,14H2,1-2H3 |
| InChIKey | FMVJIJASQCLSJR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|