C22H22O5S — CID 46246656
(2Z,4Z)-2,4-bis[(2,3-dimethoxyphenyl)methylidene]thiolan-3-one (PubChem CID 46246656) has the molecular formula C22H22O5S and a molecular weight of 398.48 g/mol. Its IUPAC name is (2Z,4Z)-2,4-bis[(2,3-dimethoxyphenyl)methylidene]thiolan-3-one.
| Compound Name | (2Z,4Z)-2,4-bis[(2,3-dimethoxyphenyl)methylidene]thiolan-3-one |
|---|---|
| PubChem CID | 46246656 |
| Molecular Formula | C22H22O5S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | (2Z,4Z)-2,4-bis[(2,3-dimethoxyphenyl)methylidene]thiolan-3-one |
| SMILES | COc1cccc(/C=C2\CS/C(=C\c3cccc(OC)c3OC)C2=O)c1OC |
| InChI | InChI=1S/C22H22O5S/c1-24-17-9-5-7-14(21(17)26-3)11-16-13-28-19(20(16)23)12-15-8-6-10-18(25-2)22(15)27-4/h5-12H,13H2,1-4H3/b16-11+,19-12- |
| InChIKey | IYOLNAKAKRBTKQ-DPYYQBSUSA-N |
| XLogP | 4.46 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|