C19H17ClN2O3S2 — CID 46246760
ethyl 2-[(4Z)-1-(3-chloro-4-methylphenyl)-5-oxo-4-(thiophen-2-ylmethylidene)imidazol-2-yl]sulfanylacetate (PubChem CID 46246760) has the molecular formula C19H17ClN2O3S2 and a molecular weight of 420.94 g/mol. Its IUPAC name is ethyl 2-[(4Z)-1-(3-chloro-4-methylphenyl)-5-oxo-4-(thiophen-2-ylmethylidene)imidazol-2-yl]sulfanylacetate.
| Compound Name | ethyl 2-[(4Z)-1-(3-chloro-4-methylphenyl)-5-oxo-4-(thiophen-2-ylmethylidene)imidazol-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 46246760 |
| Molecular Formula | C19H17ClN2O3S2 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.04 |
| IUPAC Name | ethyl 2-[(4Z)-1-(3-chloro-4-methylphenyl)-5-oxo-4-(thiophen-2-ylmethylidene)imidazol-2-yl]sulfanylacetate |
| SMILES | CCOC(=O)CSC1=N/C(=C\c2cccs2)C(=O)N1c1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C19H17ClN2O3S2/c1-3-25-17(23)11-27-19-21-16(10-14-5-4-8-26-14)18(24)22(19)13-7-6-12(2)15(20)9-13/h4-10H,3,11H2,1-2H3/b16-10- |
| InChIKey | ZWLQKWRGIHFSOB-YBEGLDIGSA-N |
| XLogP | 4.75 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|