C24H26FN3O2S — CID 46250897
N-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(2Z)-2-[(2-fluorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]acetamide (PubChem CID 46250897) has the molecular formula C24H26FN3O2S and a molecular weight of 439.56 g/mol. Its IUPAC name is N-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(2Z)-2-[(2-fluorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]acetamide.
| Compound Name | N-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(2Z)-2-[(2-fluorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]acetamide |
|---|---|
| PubChem CID | 46250897 |
| Molecular Formula | C24H26FN3O2S |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | N-[(1-ethylpyrrolidin-2-yl)methyl]-2-[(2Z)-2-[(2-fluorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]acetamide |
| SMILES | CCN1CCCC1CNC(=O)CN1C(=O)/C(=C/c2ccccc2F)Sc2ccccc21 |
| InChI | InChI=1S/C24H26FN3O2S/c1-2-27-13-7-9-18(27)15-26-23(29)16-28-20-11-5-6-12-21(20)31-22(24(28)30)14-17-8-3-4-10-19(17)25/h3-6,8,10-12,14,18H,2,7,9,13,15-16H2,1H3,(H,26,29)/b22-14- |
| InChIKey | RWUXXIGECWEONS-HMAPJEAMSA-N |
| XLogP | 3.91 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|