C25H33N3O4 — CID 46251156
2-cyclopentyl-N-(3,3-diethoxypropyl)-9-methyl-1-oxopyrido[3,4-b]indole-4-carboxamide (PubChem CID 46251156) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is 2-cyclopentyl-N-(3,3-diethoxypropyl)-9-methyl-1-oxopyrido[3,4-b]indole-4-carboxamide.
| Compound Name | 2-cyclopentyl-N-(3,3-diethoxypropyl)-9-methyl-1-oxopyrido[3,4-b]indole-4-carboxamide |
|---|---|
| PubChem CID | 46251156 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 2-cyclopentyl-N-(3,3-diethoxypropyl)-9-methyl-1-oxopyrido[3,4-b]indole-4-carboxamide |
| SMILES | CCOC(CCNC(=O)c1cn(C2CCCC2)c(=O)c2c1c1ccccc1n2C)OCC |
| InChI | InChI=1S/C25H33N3O4/c1-4-31-21(32-5-2)14-15-26-24(29)19-16-28(17-10-6-7-11-17)25(30)23-22(19)18-12-8-9-13-20(18)27(23)3/h8-9,12-13,16-17,21H,4-7,10-11,14-15H2,1-3H3,(H,26,29) |
| InChIKey | QHZWWZGYECRKHX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|