C21H24FN3O3S2 — CID 4625130
N,N-diethyl-4-[2-(4-fluorophenyl)imino-3-(2-hydroxyethyl)-1,3-thiazol-4-yl]benzenesulfonamide (PubChem CID 4625130) has the molecular formula C21H24FN3O3S2 and a molecular weight of 449.57 g/mol. Its IUPAC name is N,N-diethyl-4-[2-(4-fluorophenyl)imino-3-(2-hydroxyethyl)-1,3-thiazol-4-yl]benzenesulfonamide.
| Compound Name | N,N-diethyl-4-[2-(4-fluorophenyl)imino-3-(2-hydroxyethyl)-1,3-thiazol-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 4625130 |
| Molecular Formula | C21H24FN3O3S2 |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | N,N-diethyl-4-[2-(4-fluorophenyl)imino-3-(2-hydroxyethyl)-1,3-thiazol-4-yl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(-c2cs/c(=N\c3ccc(F)cc3)n2CCO)cc1 |
| InChI | InChI=1S/C21H24FN3O3S2/c1-3-24(4-2)30(27,28)19-11-5-16(6-12-19)20-15-29-21(25(20)13-14-26)23-18-9-7-17(22)8-10-18/h5-12,15,26H,3-4,13-14H2,1-2H3/b23-21- |
| InChIKey | OSOBTALZIIJTDW-LNVKXUELSA-N |
| XLogP | 3.61 |
| TPSA | 74.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|