C21H13F5N2O — CID 46253590
2-(2-methylphenyl)-3-(2,3,4,5,6-pentafluoroanilino)-3H-isoindol-1-one (PubChem CID 46253590) has the molecular formula C21H13F5N2O and a molecular weight of 404.34 g/mol. Its IUPAC name is 2-(2-methylphenyl)-3-(2,3,4,5,6-pentafluoroanilino)-3H-isoindol-1-one.
| Compound Name | 2-(2-methylphenyl)-3-(2,3,4,5,6-pentafluoroanilino)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 46253590 |
| Molecular Formula | C21H13F5N2O |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 2-(2-methylphenyl)-3-(2,3,4,5,6-pentafluoroanilino)-3H-isoindol-1-one |
| SMILES | Cc1ccccc1N1C(=O)c2ccccc2C1Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C21H13F5N2O/c1-10-6-2-5-9-13(10)28-20(11-7-3-4-8-12(11)21(28)29)27-19-17(25)15(23)14(22)16(24)18(19)26/h2-9,20,27H,1H3 |
| InChIKey | GNRXDJDNKBUOAH-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|