C19H14Cl4O4 — CID 4625475
2,3,4a,8a-tetrachloro-6-ethenyl-5-(3-hydroxy-4-methoxyphenyl)-5,8-dihydronaphthalene-1,4-dione (PubChem CID 4625475) has the molecular formula C19H14Cl4O4 and a molecular weight of 448.13 g/mol. Its IUPAC name is 2,3,4a,8a-tetrachloro-6-ethenyl-5-(3-hydroxy-4-methoxyphenyl)-5,8-dihydronaphthalene-1,4-dione.
| Compound Name | 2,3,4a,8a-tetrachloro-6-ethenyl-5-(3-hydroxy-4-methoxyphenyl)-5,8-dihydronaphthalene-1,4-dione |
|---|---|
| PubChem CID | 4625475 |
| Molecular Formula | C19H14Cl4O4 |
| Molecular Weight | 448.13 g/mol |
| Exact Mass | 445.96 |
| IUPAC Name | 2,3,4a,8a-tetrachloro-6-ethenyl-5-(3-hydroxy-4-methoxyphenyl)-5,8-dihydronaphthalene-1,4-dione |
| SMILES | C=CC1=CCC2(Cl)C(=O)C(Cl)=C(Cl)C(=O)C2(Cl)C1c1ccc(OC)c(O)c1 |
| InChI | InChI=1S/C19H14Cl4O4/c1-3-9-6-7-18(22)16(25)14(20)15(21)17(26)19(18,23)13(9)10-4-5-12(27-2)11(24)8-10/h3-6,8,13,24H,1,7H2,2H3 |
| InChIKey | JIFYNTVCDNFXQQ-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.13 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|