C25H15BrN2O4S — CID 46254825
(5Z)-1-(4-bromophenyl)-5-[(5-naphthalen-1-ylsulfanylfuran-2-yl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 46254825) has the molecular formula C25H15BrN2O4S and a molecular weight of 519.38 g/mol. Its IUPAC name is (5Z)-1-(4-bromophenyl)-5-[(5-naphthalen-1-ylsulfanylfuran-2-yl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5Z)-1-(4-bromophenyl)-5-[(5-naphthalen-1-ylsulfanylfuran-2-yl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 46254825 |
| Molecular Formula | C25H15BrN2O4S |
| Molecular Weight | 519.38 g/mol |
| Exact Mass | 517.99 |
| IUPAC Name | (5Z)-1-(4-bromophenyl)-5-[(5-naphthalen-1-ylsulfanylfuran-2-yl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(c2ccc(Br)cc2)C(=O)/C1=C\c1ccc(Sc2cccc3ccccc23)o1 |
| InChI | InChI=1S/C25H15BrN2O4S/c26-16-8-10-17(11-9-16)28-24(30)20(23(29)27-25(28)31)14-18-12-13-22(32-18)33-21-7-3-5-15-4-1-2-6-19(15)21/h1-14H,(H,27,29,31)/b20-14- |
| InChIKey | DPPBOCFYFPBDTA-ZHZULCJRSA-N |
| XLogP | 6.01 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.38 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|