C16H24N3OS+ — CID 4625533
[amino-[3-oxo-3-[(1-phenylcyclopentyl)methylamino]propyl]sulfanylmethylidene]azanium (PubChem CID 4625533) has the molecular formula C16H24N3OS+ and a molecular weight of 306.46 g/mol. Its IUPAC name is [amino-[3-oxo-3-[(1-phenylcyclopentyl)methylamino]propyl]sulfanylmethylidene]azanium.
| Compound Name | [amino-[3-oxo-3-[(1-phenylcyclopentyl)methylamino]propyl]sulfanylmethylidene]azanium |
|---|---|
| PubChem CID | 4625533 |
| Molecular Formula | C16H24N3OS+ |
| Molecular Weight | 306.46 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | [amino-[3-oxo-3-[(1-phenylcyclopentyl)methylamino]propyl]sulfanylmethylidene]azanium |
| SMILES | NC(=[NH2+])SCCC(=O)NCC1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C16H23N3OS/c17-15(18)21-11-8-14(20)19-12-16(9-4-5-10-16)13-6-2-1-3-7-13/h1-3,6-7H,4-5,8-12H2,(H3,17,18)(H,19,20)/p+1 |
| InChIKey | MZTIMVMPBXDMQI-UHFFFAOYSA-O |
| XLogP | 0.81 |
| TPSA | 80.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.46 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|