C23H19N3O6S — CID 46255520
4-benzyl-N-(2-methoxy-5-nitrophenyl)-1,3-dioxo-1λ4,4-benzothiazine-6-carboxamide (PubChem CID 46255520) has the molecular formula C23H19N3O6S and a molecular weight of 465.49 g/mol. Its IUPAC name is 4-benzyl-N-(2-methoxy-5-nitrophenyl)-1,3-dioxo-1λ4,4-benzothiazine-6-carboxamide.
| Compound Name | 4-benzyl-N-(2-methoxy-5-nitrophenyl)-1,3-dioxo-1λ4,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 46255520 |
| Molecular Formula | C23H19N3O6S |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 4-benzyl-N-(2-methoxy-5-nitrophenyl)-1,3-dioxo-1λ4,4-benzothiazine-6-carboxamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)c1ccc2c(c1)N(Cc1ccccc1)C(=O)CS2=O |
| InChI | InChI=1S/C23H19N3O6S/c1-32-20-9-8-17(26(29)30)12-18(20)24-23(28)16-7-10-21-19(11-16)25(22(27)14-33(21)31)13-15-5-3-2-4-6-15/h2-12H,13-14H2,1H3,(H,24,28) |
| InChIKey | SSMTYLQGOHDKIV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|