C23H20N2O4 — CID 46255708
N,2-bis(4-methoxyphenyl)-3-oxo-1H-isoindole-4-carboxamide (PubChem CID 46255708) has the molecular formula C23H20N2O4 and a molecular weight of 388.42 g/mol. Its IUPAC name is N,2-bis(4-methoxyphenyl)-3-oxo-1H-isoindole-4-carboxamide.
| Compound Name | N,2-bis(4-methoxyphenyl)-3-oxo-1H-isoindole-4-carboxamide |
|---|---|
| PubChem CID | 46255708 |
| Molecular Formula | C23H20N2O4 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | N,2-bis(4-methoxyphenyl)-3-oxo-1H-isoindole-4-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cccc3c2C(=O)N(c2ccc(OC)cc2)C3)cc1 |
| InChI | InChI=1S/C23H20N2O4/c1-28-18-10-6-16(7-11-18)24-22(26)20-5-3-4-15-14-25(23(27)21(15)20)17-8-12-19(29-2)13-9-17/h3-13H,14H2,1-2H3,(H,24,26) |
| InChIKey | ARDAACMXIDUSFA-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |