About 1-(2,3-dihydro-1H-indol-5-yl)-2-[4-(4-nitrophenyl)piperazin-1-yl]ethanol
1-(2,3-dihydro-1H-indol-5-yl)-2-[4-(4-nitrophenyl)piperazin-1-yl]ethanol (PubChem CID 46256407) has the molecular formula C20H24N4O3
and a molecular weight of 368.44 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-indol-5-yl)-2-[4-(4-nitrophenyl)piperazin-1-yl]ethanol.
Molecular Properties
| Compound Name | 1-(2,3-dihydro-1H-indol-5-yl)-2-[4-(4-nitrophenyl)piperazin-1-yl]ethanol |
| PubChem CID | 46256407 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 1-(2,3-dihydro-1H-indol-5-yl)-2-[4-(4-nitrophenyl)piperazin-1-yl]ethanol |
| SMILES | O=[N+]([O-])c1ccc(N2CCN(CC(O)c3ccc4c(c3)CCN4)CC2)cc1 |
| InChI | InChI=1S/C20H24N4O3/c25-20(16-1-6-19-15(13-16)7-8-21-19)14-22-9-11-23(12-10-22)17-2-4-18(5-3-17)24(26)27/h1-6,13,20-21,25H,7-12,14H2 |
| InChIKey | MJVXGNOUEZOQSG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 81.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,3-dihydro-1H-indol-5-yl)-2-[4-(4-nitrophenyl)piperazin-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dihydro-1H-indol-5-yl)-2-[4-(4-nitrophenyl)piperazin-1-yl]ethanol?
The IUPAC name of 1-(2,3-dihydro-1H-indol-5-yl)-2-[4-(4-nitrophenyl)piperazin-1-yl]ethanol (CID 46256407) is 1-(2,3-dihydro-1H-indol-5-yl)-2-[4-(4-nitrophenyl)piperazin-1-yl]ethanol.
What is the SMILES notation for 1-(2,3-dihydro-1H-indol-5-yl)-2-[4-(4-nitrophenyl)piperazin-1-yl]ethanol?
The canonical SMILES for 1-(2,3-dihydro-1H-indol-5-yl)-2-[4-(4-nitrophenyl)piperazin-1-yl]ethanol is O=[N+]([O-])c1ccc(N2CCN(CC(O)c3ccc4c(c3)CCN4)CC2)cc1.
What is the InChIKey of 1-(2,3-dihydro-1H-indol-5-yl)-2-[4-(4-nitrophenyl)piperazin-1-yl]ethanol?
The InChIKey is MJVXGNOUEZOQSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N4O3/c25-20(16-1-6-19-15(13-16)7-8-21-19)14-22-9-11-23(12-10-22)17-2-4-18(5-3-17)24(26)27/h1-6,13,20-21,25H,7-12,14H2.
What are the key properties of 1-(2,3-dihydro-1H-indol-5-yl)-2-[4-(4-nitrophenyl)piperazin-1-yl]ethanol?
1-(2,3-dihydro-1H-indol-5-yl)-2-[4-(4-nitrophenyl)piperazin-1-yl]ethanol has a molecular weight of 368.44 g/mol, XLogP of 2.42, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dihydro-1H-indol-5-yl)-2-[4-(4-nitrophenyl)piperazin-1-yl]ethanol is sourced from PubChem (CID 46256407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).