About 4-chloro-N-(5-chloro-2-methylphenyl)-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide
4-chloro-N-(5-chloro-2-methylphenyl)-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide (PubChem CID 46256939) has the molecular formula C21H16Cl2N2OS
and a molecular weight of 415.35 g/mol. Its IUPAC name is 4-chloro-N-(5-chloro-2-methylphenyl)-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide.
Molecular Properties
| Compound Name | 4-chloro-N-(5-chloro-2-methylphenyl)-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide |
| PubChem CID | 46256939 |
| Molecular Formula | C21H16Cl2N2OS |
| Molecular Weight | 415.35 g/mol |
| Exact Mass | 414.04 |
| IUPAC Name | 4-chloro-N-(5-chloro-2-methylphenyl)-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide |
| SMILES | Cc1ccc2nc(Cl)c3cc(C(=O)N(C)c4cc(Cl)ccc4C)sc3c2c1 |
| InChI | InChI=1S/C21H16Cl2N2OS/c1-11-4-7-16-14(8-11)19-15(20(23)24-16)10-18(27-19)21(26)25(3)17-9-13(22)6-5-12(17)2/h4-10H,1-3H3 |
| InChIKey | VZUDLYULJAIYMD-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.35 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-N-(5-chloro-2-methylphenyl)-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-(5-chloro-2-methylphenyl)-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide?
The IUPAC name of 4-chloro-N-(5-chloro-2-methylphenyl)-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide (CID 46256939) is 4-chloro-N-(5-chloro-2-methylphenyl)-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide.
What is the SMILES notation for 4-chloro-N-(5-chloro-2-methylphenyl)-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide?
The canonical SMILES for 4-chloro-N-(5-chloro-2-methylphenyl)-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide is Cc1ccc2nc(Cl)c3cc(C(=O)N(C)c4cc(Cl)ccc4C)sc3c2c1.
What is the InChIKey of 4-chloro-N-(5-chloro-2-methylphenyl)-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide?
The InChIKey is VZUDLYULJAIYMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16Cl2N2OS/c1-11-4-7-16-14(8-11)19-15(20(23)24-16)10-18(27-19)21(26)25(3)17-9-13(22)6-5-12(17)2/h4-10H,1-3H3.
What are the key properties of 4-chloro-N-(5-chloro-2-methylphenyl)-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide?
4-chloro-N-(5-chloro-2-methylphenyl)-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide has a molecular weight of 415.35 g/mol, XLogP of 6.65, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-(5-chloro-2-methylphenyl)-N,8-dimethylthieno[3,2-c]quinoline-2-carboxamide is sourced from PubChem (CID 46256939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).