C29H23N3O2 — CID 46257130
12-(benzylamino)-10-(2,5-dimethylanilino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one (PubChem CID 46257130) has the molecular formula C29H23N3O2 and a molecular weight of 445.52 g/mol. Its IUPAC name is 12-(benzylamino)-10-(2,5-dimethylanilino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one.
| Compound Name | 12-(benzylamino)-10-(2,5-dimethylanilino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
|---|---|
| PubChem CID | 46257130 |
| Molecular Formula | C29H23N3O2 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 12-(benzylamino)-10-(2,5-dimethylanilino)-15-oxa-14-azatetracyclo[7.6.1.02,7.013,16]hexadeca-1(16),2,4,6,9,11,13-heptaen-8-one |
| SMILES | Cc1ccc(C)c(Nc2cc(NCc3ccccc3)c3noc4c3c2C(=O)c2ccccc2-4)c1 |
| InChI | InChI=1S/C29H23N3O2/c1-17-12-13-18(2)22(14-17)31-23-15-24(30-16-19-8-4-3-5-9-19)27-26-25(23)28(33)20-10-6-7-11-21(20)29(26)34-32-27/h3-15,30-31H,16H2,1-2H3 |
| InChIKey | NTARDEORYJLMAL-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'quinone_B(5)', 'substructure': 'N/A'} |
|---|