C24H21N3O5S — CID 46257266
(2Z)-2-(benzenesulfonylhydrazinylidene)-8-methoxy-N-(2-methylphenyl)chromene-3-carboxamide (PubChem CID 46257266) has the molecular formula C24H21N3O5S and a molecular weight of 463.52 g/mol. Its IUPAC name is (2Z)-2-(benzenesulfonylhydrazinylidene)-8-methoxy-N-(2-methylphenyl)chromene-3-carboxamide.
| Compound Name | (2Z)-2-(benzenesulfonylhydrazinylidene)-8-methoxy-N-(2-methylphenyl)chromene-3-carboxamide |
|---|---|
| PubChem CID | 46257266 |
| Molecular Formula | C24H21N3O5S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | (2Z)-2-(benzenesulfonylhydrazinylidene)-8-methoxy-N-(2-methylphenyl)chromene-3-carboxamide |
| SMILES | COc1cccc2cc(C(=O)Nc3ccccc3C)/c(=N/NS(=O)(=O)c3ccccc3)oc12 |
| InChI | InChI=1S/C24H21N3O5S/c1-16-9-6-7-13-20(16)25-23(28)19-15-17-10-8-14-21(31-2)22(17)32-24(19)26-27-33(29,30)18-11-4-3-5-12-18/h3-15,27H,1-2H3,(H,25,28)/b26-24- |
| InChIKey | BTRAPYUJJUOJQX-LCUIJRPUSA-N |
| XLogP | 3.80 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|